C24H23N3O5S — CID 135278916
2-[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]acetamide (PubChem CID 135278916) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]acetamide.
| Compound Name | 2-[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 135278916 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(Oc2ccc(CC(N)=O)cc2)c(-c2cc(C)n(O)c3nccc2-3)c1 |
| InChI | InChI=1S/C24H23N3O5S/c1-3-33(30,31)18-8-9-22(32-17-6-4-16(5-7-17)13-23(25)28)21(14-18)20-12-15(2)27(29)24-19(20)10-11-26-24/h4-12,14,29H,3,13H2,1-2H3,(H2,25,28) |
| InChIKey | ZNEQWGBNRNLRLZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|