C28H31N3O6S — CID 135279136
tert-butyl N-[[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]methyl]carbamate (PubChem CID 135279136) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135279136 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | tert-butyl N-[[4-[4-ethylsulfonyl-2-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)phenoxy]phenyl]methyl]carbamate |
| SMILES | CCS(=O)(=O)c1ccc(Oc2ccc(CNC(=O)OC(C)(C)C)cc2)c(-c2cc(C)n(O)c3nccc2-3)c1 |
| InChI | InChI=1S/C28H31N3O6S/c1-6-38(34,35)21-11-12-25(24(16-21)23-15-18(2)31(33)26-22(23)13-14-29-26)36-20-9-7-19(8-10-20)17-30-27(32)37-28(3,4)5/h7-16,33H,6,17H2,1-5H3,(H,30,32) |
| InChIKey | UXDNWVSCBBFNLH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|