C24H15F9N2O4S — CID 146714086
4-[5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)-2-[3-(trifluoromethyl)phenoxy]phenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine (PubChem CID 146714086) has the molecular formula C24H15F9N2O4S and a molecular weight of 598.44 g/mol. Its IUPAC name is 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)-2-[3-(trifluoromethyl)phenoxy]phenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)-2-[3-(trifluoromethyl)phenoxy]phenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 146714086 |
| Molecular Formula | C24H15F9N2O4S |
| Molecular Weight | 598.44 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | 4-[5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)-2-[3-(trifluoromethyl)phenoxy]phenyl]-7-hydroxy-6-methylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc(-c2cc(S(=O)(=O)C(C(F)(F)F)C(F)(F)F)ccc2Oc2cccc(C(F)(F)F)c2)c2ccnc-2n1O |
| InChI | InChI=1S/C24H15F9N2O4S/c1-12-9-17(16-7-8-34-20(16)35(12)36)18-11-15(40(37,38)21(23(28,29)30)24(31,32)33)5-6-19(18)39-14-4-2-3-13(10-14)22(25,26)27/h2-11,21,36H,1H3 |
| InChIKey | KNLRRQOXNRSEGC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.44 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|