C20H15F3N4O2 — CID 135278717
5-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)-6-[3-(trifluoromethyl)phenoxy]pyridin-3-amine (PubChem CID 135278717) has the molecular formula C20H15F3N4O2 and a molecular weight of 400.36 g/mol. Its IUPAC name is 5-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)-6-[3-(trifluoromethyl)phenoxy]pyridin-3-amine.
| Compound Name | 5-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)-6-[3-(trifluoromethyl)phenoxy]pyridin-3-amine |
|---|---|
| PubChem CID | 135278717 |
| Molecular Formula | C20H15F3N4O2 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-(7-hydroxy-6-methylpyrrolo[2,3-b]pyridin-4-yl)-6-[3-(trifluoromethyl)phenoxy]pyridin-3-amine |
| SMILES | Cc1cc(-c2cc(N)cnc2Oc2cccc(C(F)(F)F)c2)c2ccnc-2n1O |
| InChI | InChI=1S/C20H15F3N4O2/c1-11-7-16(15-5-6-25-18(15)27(11)28)17-9-13(24)10-26-19(17)29-14-4-2-3-12(8-14)20(21,22)23/h2-10,28H,24H2,1H3 |
| InChIKey | LAMNDNZKVOLHFT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|