C12H16O2 — CID 155762012
1,4-bis(ethenoxymethylidene)cyclohexane (PubChem CID 155762012) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1,4-bis(ethenoxymethylidene)cyclohexane.
| Compound Name | 1,4-bis(ethenoxymethylidene)cyclohexane |
|---|---|
| PubChem CID | 155762012 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 1,4-bis(ethenoxymethylidene)cyclohexane |
| SMILES | C=COC=C1CCC(=COC=C)CC1 |
| InChI | InChI=1S/C12H16O2/c1-3-13-9-11-5-7-12(8-6-11)10-14-4-2/h3-4,9-10H,1-2,5-8H2/b11-9-,12-10+ |
| InChIKey | DOUSXVBXIQYZLI-DSOJMZEYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|