C18H16N2O4S — CID 155762159
2-(3-methylsulfonylpropoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one (PubChem CID 155762159) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-(3-methylsulfonylpropoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one.
| Compound Name | 2-(3-methylsulfonylpropoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
|---|---|
| PubChem CID | 155762159 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-(3-methylsulfonylpropoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
| SMILES | CS(=O)(=O)CCCOc1c2c(nc3ccccc13)-c1cccn1C2=O |
| InChI | InChI=1S/C18H16N2O4S/c1-25(22,23)11-5-10-24-17-12-6-2-3-7-13(12)19-16-14-8-4-9-20(14)18(21)15(16)17/h2-4,6-9H,5,10-11H2,1H3 |
| InChIKey | VJWCQQCGJJEJAJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|