C16H11FN2O2 — CID 155762144
2-(2-fluoroethoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one (PubChem CID 155762144) has the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one.
| Compound Name | 2-(2-fluoroethoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
|---|---|
| PubChem CID | 155762144 |
| Molecular Formula | C16H11FN2O2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(2-fluoroethoxy)-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11,13-heptaen-16-one |
| SMILES | O=C1c2c(nc3ccccc3c2OCCF)-c2cccn21 |
| InChI | InChI=1S/C16H11FN2O2/c17-7-9-21-15-10-4-1-2-5-11(10)18-14-12-6-3-8-19(12)16(20)13(14)15/h1-6,8H,7,9H2 |
| InChIKey | TUVZEKVQNUUKIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |