C19H11NO3 — CID 102027445
9-phenoxyacridine-1,4-dione (PubChem CID 102027445) has the molecular formula C19H11NO3 and a molecular weight of 301.30 g/mol. Its IUPAC name is 9-phenoxyacridine-1,4-dione.
| Compound Name | 9-phenoxyacridine-1,4-dione |
|---|---|
| PubChem CID | 102027445 |
| Molecular Formula | C19H11NO3 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 9-phenoxyacridine-1,4-dione |
| SMILES | O=C1C=CC(=O)c2c1nc1ccccc1c2Oc1ccccc1 |
| InChI | InChI=1S/C19H11NO3/c21-15-10-11-16(22)18-17(15)19(23-12-6-2-1-3-7-12)13-8-4-5-9-14(13)20-18/h1-11H |
| InChIKey | OPDAGWYFAJDQLW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|