C18H15NO2Si — CID 639598
9-(2-trimethylsilylethynyl)acridine-1,4-dione (PubChem CID 639598) has the molecular formula C18H15NO2Si and a molecular weight of 305.41 g/mol. Its IUPAC name is 9-(2-trimethylsilylethynyl)acridine-1,4-dione.
| Compound Name | 9-(2-trimethylsilylethynyl)acridine-1,4-dione |
|---|---|
| PubChem CID | 639598 |
| Molecular Formula | C18H15NO2Si |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 9-(2-trimethylsilylethynyl)acridine-1,4-dione |
| SMILES | C[Si](C)(C)C#Cc1c2c(nc3ccccc13)C(=O)C=CC2=O |
| InChI | InChI=1S/C18H15NO2Si/c1-22(2,3)11-10-13-12-6-4-5-7-14(12)19-18-16(21)9-8-15(20)17(13)18/h4-9H,1-3H3 |
| InChIKey | KUSSGTHCQRWTOF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|