C17H16Si — CID 11079621
trimethyl-[2-[2-(2-phenylethynyl)cyclobuta-1,3-dien-1-yl]ethynyl]silane (PubChem CID 11079621) has the molecular formula C17H16Si and a molecular weight of 248.40 g/mol. Its IUPAC name is trimethyl-[2-[2-(2-phenylethynyl)cyclobuta-1,3-dien-1-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[2-(2-phenylethynyl)cyclobuta-1,3-dien-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 11079621 |
| Molecular Formula | C17H16Si |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | trimethyl-[2-[2-(2-phenylethynyl)cyclobuta-1,3-dien-1-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1=C(C#Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C17H16Si/c1-18(2,3)14-13-17-12-11-16(17)10-9-15-7-5-4-6-8-15/h4-8,11-12H,1-3H3 |
| InChIKey | YECIYDLPBYQKFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|