C15H17NSi — CID 101176241
trimethyl-[2-[(2R,3R)-3-(2-phenylethynyl)aziridin-2-yl]ethynyl]silane (PubChem CID 101176241) has the molecular formula C15H17NSi and a molecular weight of 239.39 g/mol. Its IUPAC name is trimethyl-[2-[(2R,3R)-3-(2-phenylethynyl)aziridin-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2R,3R)-3-(2-phenylethynyl)aziridin-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 101176241 |
| Molecular Formula | C15H17NSi |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | trimethyl-[2-[(2R,3R)-3-(2-phenylethynyl)aziridin-2-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@H]1N[C@@H]1C#Cc1ccccc1 |
| InChI | InChI=1S/C15H17NSi/c1-17(2,3)12-11-15-14(16-15)10-9-13-7-5-4-6-8-13/h4-8,14-16H,1-3H3/t14-,15-/m1/s1 |
| InChIKey | KBZUHTCSHQJMAJ-HUUCEWRRSA-N |
| XLogP | 2.26 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|