C33H20BN5 — CID 155765294
CID 155765294 (PubChem CID 155765294) has the molecular formula C33H20BN5 and a molecular weight of 497.37 g/mol.
| Compound Name | CID 155765294 |
|---|---|
| PubChem CID | 155765294 |
| Molecular Formula | C33H20BN5 |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2c(ccc3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cnc32)c1 |
| InChI | InChI=1S/C33H20BN5/c34-28-18-26-16-15-25-17-27(19-35-29(25)30(26)36-20-28)21-11-13-24(14-12-21)33-38-31(22-7-3-1-4-8-22)37-32(39-33)23-9-5-2-6-10-23/h1-20H |
| InChIKey | ZHZJCAKASFTGQM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|