C19H34N4O — CID 155769124
2-methyl-N-[3-[[6-(4-propan-2-ylpiperazin-1-yl)-3-pyridinyl]oxy]propyl]propan-2-amine (PubChem CID 155769124) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-methyl-N-[3-[[6-(4-propan-2-ylpiperazin-1-yl)-3-pyridinyl]oxy]propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[3-[[6-(4-propan-2-ylpiperazin-1-yl)-3-pyridinyl]oxy]propyl]propan-2-amine |
|---|---|
| PubChem CID | 155769124 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 2-methyl-N-[3-[[6-(4-propan-2-ylpiperazin-1-yl)-3-pyridinyl]oxy]propyl]propan-2-amine |
| SMILES | CC(C)N1CCN(c2ccc(OCCCNC(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C19H34N4O/c1-16(2)22-10-12-23(13-11-22)18-8-7-17(15-20-18)24-14-6-9-21-19(3,4)5/h7-8,15-16,21H,6,9-14H2,1-5H3 |
| InChIKey | NBYSQSFIABILLV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|