About N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine
N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine (PubChem CID 177295907) has the molecular formula C16H26F2N4O
and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine |
| PubChem CID | 177295907 |
| Molecular Formula | C16H26F2N4O |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC(F)(F)COc1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C16H26F2N4O/c1-15(2,3)21-11-16(17,18)12-23-13-4-5-14(20-10-13)22-8-6-19-7-9-22/h4-5,10,19,21H,6-9,11-12H2,1-3H3 |
| InChIKey | JIKGOXPETACMIV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine (CID 177295907) is N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine is CC(C)(C)NCC(F)(F)COc1ccc(N2CCNCC2)nc1.
What is the InChIKey of N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine?
The InChIKey is JIKGOXPETACMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26F2N4O/c1-15(2,3)21-11-16(17,18)12-23-13-4-5-14(20-10-13)22-8-6-19-7-9-22/h4-5,10,19,21H,6-9,11-12H2,1-3H3.
What are the key properties of N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine?
N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine has a molecular weight of 328.41 g/mol, XLogP of 1.89, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-difluoro-3-[(6-piperazin-1-yl-3-pyridinyl)oxy]propyl]-2-methylpropan-2-amine is sourced from PubChem (CID 177295907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).