C21H32N2O2S — CID 155770366
N-[[1-(dimethylcarbamoyl)-2-methylcyclopentyl]methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 155770366) has the molecular formula C21H32N2O2S and a molecular weight of 376.57 g/mol. Its IUPAC name is N-[[1-(dimethylcarbamoyl)-2-methylcyclopentyl]methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[[1-(dimethylcarbamoyl)-2-methylcyclopentyl]methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155770366 |
| Molecular Formula | C21H32N2O2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[[1-(dimethylcarbamoyl)-2-methylcyclopentyl]methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | CC1CCCC1(CNC(=O)c1cc2c(s1)CCCCCC2)C(=O)N(C)C |
| InChI | InChI=1S/C21H32N2O2S/c1-15-9-8-12-21(15,20(25)23(2)3)14-22-19(24)18-13-16-10-6-4-5-7-11-17(16)26-18/h13,15H,4-12,14H2,1-3H3,(H,22,24) |
| InChIKey | AJKHKAVTMCZJDU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |