C17H21F2NO3S — CID 155770403
3,3-difluoro-1-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)methyl]cyclobutane-1-carboxylic acid (PubChem CID 155770403) has the molecular formula C17H21F2NO3S and a molecular weight of 357.42 g/mol. Its IUPAC name is 3,3-difluoro-1-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 3,3-difluoro-1-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770403 |
| Molecular Formula | C17H21F2NO3S |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3,3-difluoro-1-[(4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carbonylamino)methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CC(F)(F)C1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C17H21F2NO3S/c18-17(19)8-16(9-17,15(22)23)10-20-14(21)13-7-11-5-3-1-2-4-6-12(11)24-13/h7H,1-6,8-10H2,(H,20,21)(H,22,23) |
| InChIKey | GTJCLDVALLKMKB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |