C26H16ClF3N2O4 — CID 155772188
3-[(6-carboxy-1H-indol-3-yl)-chloro-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid (PubChem CID 155772188) has the molecular formula C26H16ClF3N2O4 and a molecular weight of 512.87 g/mol. Its IUPAC name is 3-[(6-carboxy-1H-indol-3-yl)-chloro-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid.
| Compound Name | 3-[(6-carboxy-1H-indol-3-yl)-chloro-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 155772188 |
| Molecular Formula | C26H16ClF3N2O4 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 3-[(6-carboxy-1H-indol-3-yl)-chloro-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C(Cl)(c3ccc(C(F)(F)F)cc3)c3c[nH]c4cc(C(=O)O)ccc34)c[nH]c2c1 |
| InChI | InChI=1S/C26H16ClF3N2O4/c27-25(15-3-5-16(6-4-15)26(28,29)30,19-11-31-21-9-13(23(33)34)1-7-17(19)21)20-12-32-22-10-14(24(35)36)2-8-18(20)22/h1-12,31-32H,(H,33,34)(H,35,36) |
| InChIKey | WMCKCCMEZRTYEP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|