C27H22ClF3N2 — CID 155772223
3-[chloro-(1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]-1-propylindole (PubChem CID 155772223) has the molecular formula C27H22ClF3N2 and a molecular weight of 466.93 g/mol. Its IUPAC name is 3-[chloro-(1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]-1-propylindole.
| Compound Name | 3-[chloro-(1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]-1-propylindole |
|---|---|
| PubChem CID | 155772223 |
| Molecular Formula | C27H22ClF3N2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 3-[chloro-(1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methyl]-1-propylindole |
| SMILES | CCCn1cc(C(Cl)(c2ccc(C(F)(F)F)cc2)c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H22ClF3N2/c1-2-15-33-17-23(21-8-4-6-10-25(21)33)26(28,18-11-13-19(14-12-18)27(29,30)31)22-16-32-24-9-5-3-7-20(22)24/h3-14,16-17,32H,2,15H2,1H3 |
| InChIKey | PUQLRBZMANNPAJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|