C22H25F3N6O5 — CID 155773794
9-[3-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 155773794) has the molecular formula C22H25F3N6O5 and a molecular weight of 510.47 g/mol. Its IUPAC name is 9-[3-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 9-[3-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 155773794 |
| Molecular Formula | C22H25F3N6O5 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 9-[3-[(2R)-2,3-dihydroxypropoxy]-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(N)=O)C1(c3ncccc3OC[C@H](O)CO)CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3N6O5/c1-12(22(23,24)25)28-19(34)14-4-5-15-18(29-14)31(20(26)35)21(6-8-30(15)11-21)17-16(3-2-7-27-17)36-10-13(33)9-32/h2-5,7,12-13,32-33H,6,8-11H2,1H3,(H2,26,35)(H,28,34)/t12-,13-,21?/m1/s1 |
| InChIKey | XLBVRWMNUYAGOA-AZWPRIFCSA-N |
| XLogP | 0.89 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |