C30H33N5O — CID 155777579
4-[5-(3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide (PubChem CID 155777579) has the molecular formula C30H33N5O and a molecular weight of 479.63 g/mol. Its IUPAC name is 4-[5-(3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[5-(3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 155777579 |
| Molecular Formula | C30H33N5O |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 4-[5-(3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide |
| SMILES | Cc1cc(-c2cnc3[nH]cc(-c4ccc(C(=O)N(C)C)cc4)c3c2)cc2c1N1CCN(C)CC1CC2 |
| InChI | InChI=1S/C30H33N5O/c1-19-13-23(14-22-9-10-25-18-34(4)11-12-35(25)28(19)22)24-15-26-27(17-32-29(26)31-16-24)20-5-7-21(8-6-20)30(36)33(2)3/h5-8,13-17,25H,9-12,18H2,1-4H3,(H,31,32) |
| InChIKey | FCFWIYXNBGVWAG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |