C34H40N6O2 — CID 155777567
4-[2-[(4aR)-3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,2-dimethyl-N-[[(3S)-oxolan-3-yl]methyl]benzamide (PubChem CID 155777567) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 4-[2-[(4aR)-3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,2-dimethyl-N-[[(3S)-oxolan-3-yl]methyl]benzamide.
| Compound Name | 4-[2-[(4aR)-3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,2-dimethyl-N-[[(3S)-oxolan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 155777567 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 4-[2-[(4aR)-3,10-dimethyl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-8-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,2-dimethyl-N-[[(3S)-oxolan-3-yl]methyl]benzamide |
| SMILES | Cc1cc(-c2c[nH]c3ncc(-c4cc(C)c5c(c4)CC[C@@H]4CN(C)CCN54)nc23)ccc1C(=O)N(C)C[C@@H]1CCOC1 |
| InChI | InChI=1S/C34H40N6O2/c1-21-13-24(6-8-28(21)34(41)39(4)18-23-9-12-42-20-23)29-16-35-33-31(29)37-30(17-36-33)26-14-22(2)32-25(15-26)5-7-27-19-38(3)10-11-40(27)32/h6,8,13-17,23,27H,5,7,9-12,18-20H2,1-4H3,(H,35,36)/t23-,27+/m0/s1 |
| InChIKey | VEPYERRJEDKFTO-WNCULLNHSA-N |
| XLogP | 5.08 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |