C28H30N2O3 — CID 155779132
ethane;3-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 155779132) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is ethane;3-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | ethane;3-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 155779132 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | ethane;3-(7-methoxyquinolin-4-yl)oxy-2-methyl-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | CC.COc1ccc2c(Oc3cccc(C(=O)NCc4cccc(C)c4)c3C)ccnc2c1 |
| InChI | InChI=1S/C26H24N2O3.C2H6/c1-17-6-4-7-19(14-17)16-28-26(29)21-8-5-9-24(18(21)2)31-25-12-13-27-23-15-20(30-3)10-11-22(23)25;1-2/h4-15H,16H2,1-3H3,(H,28,29);1-2H3 |
| InChIKey | SHWSZUXBIDNUAE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |