C29H29N3O3 — CID 167602082
2-methyl-3-(7-methylquinolin-4-yl)oxy-N-[(3-morpholin-4-ylphenyl)methyl]benzamide (PubChem CID 167602082) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-methyl-3-(7-methylquinolin-4-yl)oxy-N-[(3-morpholin-4-ylphenyl)methyl]benzamide.
| Compound Name | 2-methyl-3-(7-methylquinolin-4-yl)oxy-N-[(3-morpholin-4-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 167602082 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-methyl-3-(7-methylquinolin-4-yl)oxy-N-[(3-morpholin-4-ylphenyl)methyl]benzamide |
| SMILES | Cc1ccc2c(Oc3cccc(C(=O)NCc4cccc(N5CCOCC5)c4)c3C)ccnc2c1 |
| InChI | InChI=1S/C29H29N3O3/c1-20-9-10-25-26(17-20)30-12-11-28(25)35-27-8-4-7-24(21(27)2)29(33)31-19-22-5-3-6-23(18-22)32-13-15-34-16-14-32/h3-12,17-18H,13-16,19H2,1-2H3,(H,31,33) |
| InChIKey | JWLSSAKFGJUNFY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |