C22H21FN6O — CID 155779982
7-fluoro-1-(3-methoxypropyl)-4-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]indazole (PubChem CID 155779982) has the molecular formula C22H21FN6O and a molecular weight of 404.45 g/mol. Its IUPAC name is 7-fluoro-1-(3-methoxypropyl)-4-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]indazole.
| Compound Name | 7-fluoro-1-(3-methoxypropyl)-4-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]indazole |
|---|---|
| PubChem CID | 155779982 |
| Molecular Formula | C22H21FN6O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 7-fluoro-1-(3-methoxypropyl)-4-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]indazole |
| SMILES | COCCCn1ncc2c([C@@H]3C[C@@H]3c3cnc(-c4ncccn4)nc3)ccc(F)c21 |
| InChI | InChI=1S/C22H21FN6O/c1-30-9-3-8-29-20-18(13-28-29)15(4-5-19(20)23)17-10-16(17)14-11-26-22(27-12-14)21-24-6-2-7-25-21/h2,4-7,11-13,16-17H,3,8-10H2,1H3/t16-,17+/m1/s1 |
| InChIKey | DPAZFDQMICHXGV-SJORKVTESA-N |
| XLogP | 3.73 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|