C23H23F2N5O2 — CID 155780186
5-[(1R,2S)-2-[3,4-difluoro-5-[3-(2-methoxyethoxy)azetidin-1-yl]phenyl]cyclopropyl]-2-pyrimidin-2-ylpyrimidine (PubChem CID 155780186) has the molecular formula C23H23F2N5O2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 5-[(1R,2S)-2-[3,4-difluoro-5-[3-(2-methoxyethoxy)azetidin-1-yl]phenyl]cyclopropyl]-2-pyrimidin-2-ylpyrimidine.
| Compound Name | 5-[(1R,2S)-2-[3,4-difluoro-5-[3-(2-methoxyethoxy)azetidin-1-yl]phenyl]cyclopropyl]-2-pyrimidin-2-ylpyrimidine |
|---|---|
| PubChem CID | 155780186 |
| Molecular Formula | C23H23F2N5O2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[(1R,2S)-2-[3,4-difluoro-5-[3-(2-methoxyethoxy)azetidin-1-yl]phenyl]cyclopropyl]-2-pyrimidin-2-ylpyrimidine |
| SMILES | COCCOC1CN(c2cc([C@H]3C[C@H]3c3cnc(-c4ncccn4)nc3)cc(F)c2F)C1 |
| InChI | InChI=1S/C23H23F2N5O2/c1-31-5-6-32-16-12-30(13-16)20-8-14(7-19(24)21(20)25)17-9-18(17)15-10-28-23(29-11-15)22-26-3-2-4-27-22/h2-4,7-8,10-11,16-18H,5-6,9,12-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | ZYDQWCYXQVWPPH-MSOLQXFVSA-N |
| XLogP | 3.33 |
| TPSA | 73.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|