About 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid
4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid (PubChem CID 155782142) has the molecular formula C25H32ClNO6
and a molecular weight of 477.99 g/mol. Its IUPAC name is 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid |
| PubChem CID | 155782142 |
| Molecular Formula | C25H32ClNO6 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid |
| SMILES | CCOC(=O)c1c(C(=O)CC(C)CCCC(C)C)c2ccc(Cl)cc2n1C(=O)CCC(=O)O |
| InChI | InChI=1S/C25H32ClNO6/c1-5-33-25(32)24-23(20(28)13-16(4)8-6-7-15(2)3)18-10-9-17(26)14-19(18)27(24)21(29)11-12-22(30)31/h9-10,14-16H,5-8,11-13H2,1-4H3,(H,30,31) |
| InChIKey | XIUQGFMCDIHRHL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid?
The IUPAC name of 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid (CID 155782142) is 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid?
The canonical SMILES for 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid is CCOC(=O)c1c(C(=O)CC(C)CCCC(C)C)c2ccc(Cl)cc2n1C(=O)CCC(=O)O.
What is the InChIKey of 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid?
The InChIKey is XIUQGFMCDIHRHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32ClNO6/c1-5-33-25(32)24-23(20(28)13-16(4)8-6-7-15(2)3)18-10-9-17(26)14-19(18)27(24)21(29)11-12-22(30)31/h9-10,14-16H,5-8,11-13H2,1-4H3,(H,30,31).
What are the key properties of 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid?
4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid has a molecular weight of 477.99 g/mol, XLogP of 6.01, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-chloro-3-(3,7-dimethyloctanoyl)-2-ethoxycarbonylindol-1-yl]-4-oxobutanoic acid is sourced from PubChem (CID 155782142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).