C22H31N7O3 — CID 155786395
N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]cyclohexyl]-2-imidazol-1-yl-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide (PubChem CID 155786395) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]cyclohexyl]-2-imidazol-1-yl-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide.
| Compound Name | N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]cyclohexyl]-2-imidazol-1-yl-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 155786395 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]cyclohexyl]-2-imidazol-1-yl-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
| SMILES | CN(C)CCOCCOC1CCC(NC(=O)c2nc(-n3ccnc3)nc3cc[nH]c23)CC1 |
| InChI | InChI=1S/C22H31N7O3/c1-28(2)11-12-31-13-14-32-17-5-3-16(4-6-17)25-21(30)20-19-18(7-8-24-19)26-22(27-20)29-10-9-23-15-29/h7-10,15-17,24H,3-6,11-14H2,1-2H3,(H,25,30) |
| InChIKey | XTVPDUPOFPTCTP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|