C21H26N6O3 — CID 156885976
2,6-di(imidazol-1-yl)-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide (PubChem CID 156885976) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2,6-di(imidazol-1-yl)-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide.
| Compound Name | 2,6-di(imidazol-1-yl)-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 156885976 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2,6-di(imidazol-1-yl)-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide |
| SMILES | COCCOC1CCC(NC(=O)c2cc(-n3ccnc3)nc(-n3ccnc3)c2)CC1 |
| InChI | InChI=1S/C21H26N6O3/c1-29-10-11-30-18-4-2-17(3-5-18)24-21(28)16-12-19(26-8-6-22-14-26)25-20(13-16)27-9-7-23-15-27/h6-9,12-15,17-18H,2-5,10-11H2,1H3,(H,24,28) |
| InChIKey | XMHQFQHGHKOFFW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|