C21H28N4O3 — CID 171566244
3-[(2S)-2-hydroxypyrrolidin-1-yl]-5-imidazol-1-yl-N-(4-methoxycyclohexyl)benzamide (PubChem CID 171566244) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxypyrrolidin-1-yl]-5-imidazol-1-yl-N-(4-methoxycyclohexyl)benzamide.
| Compound Name | 3-[(2S)-2-hydroxypyrrolidin-1-yl]-5-imidazol-1-yl-N-(4-methoxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 171566244 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-[(2S)-2-hydroxypyrrolidin-1-yl]-5-imidazol-1-yl-N-(4-methoxycyclohexyl)benzamide |
| SMILES | COC1CCC(NC(=O)c2cc(N3CCC[C@@H]3O)cc(-n3ccnc3)c2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-28-19-6-4-16(5-7-19)23-21(27)15-11-17(24-10-8-22-14-24)13-18(12-15)25-9-2-3-20(25)26/h8,10-14,16,19-20,26H,2-7,9H2,1H3,(H,23,27)/t16?,19?,20-/m0/s1 |
| InChIKey | HKWNFLUGUCTUGV-GQOXECLESA-N |
| XLogP | 2.48 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |