C14H15N5OS — CID 169357814
3-(carbamothioylamino)-N-cyclopropyl-4-imidazol-1-ylbenzamide (PubChem CID 169357814) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 3-(carbamothioylamino)-N-cyclopropyl-4-imidazol-1-ylbenzamide.
| Compound Name | 3-(carbamothioylamino)-N-cyclopropyl-4-imidazol-1-ylbenzamide |
|---|---|
| PubChem CID | 169357814 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(carbamothioylamino)-N-cyclopropyl-4-imidazol-1-ylbenzamide |
| SMILES | NC(=S)Nc1cc(C(=O)NC2CC2)ccc1-n1ccnc1 |
| InChI | InChI=1S/C14H15N5OS/c15-14(21)18-11-7-9(13(20)17-10-2-3-10)1-4-12(11)19-6-5-16-8-19/h1,4-8,10H,2-3H2,(H,17,20)(H3,15,18,21) |
| InChIKey | ZOESABHAGWJSLP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|