C18H24N4O3 — CID 156885753
2-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide (PubChem CID 156885753) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide.
| Compound Name | 2-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 156885753 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]pyridine-4-carboxamide |
| SMILES | COCCOC1CCC(NC(=O)c2ccnc(-n3ccnc3)c2)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-10-11-25-16-4-2-15(3-5-16)21-18(23)14-6-7-20-17(12-14)22-9-8-19-13-22/h6-9,12-13,15-16H,2-5,10-11H2,1H3,(H,21,23) |
| InChIKey | ROHVSWYPCYJUQD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|