C18H28N4O3 — CID 156885840
N-cyclohexyl-6-imidazol-1-ylpyridine-2-carboxamide;2-methoxyethanol;molecular hydrogen (PubChem CID 156885840) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-cyclohexyl-6-imidazol-1-ylpyridine-2-carboxamide;2-methoxyethanol;molecular hydrogen.
| Compound Name | N-cyclohexyl-6-imidazol-1-ylpyridine-2-carboxamide;2-methoxyethanol;molecular hydrogen |
|---|---|
| PubChem CID | 156885840 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-cyclohexyl-6-imidazol-1-ylpyridine-2-carboxamide;2-methoxyethanol;molecular hydrogen |
| SMILES | COCCO.O=C(NC1CCCCC1)c1cccc(-n2ccnc2)n1.[H][H] |
| InChI | InChI=1S/C15H18N4O.C3H8O2.H2/c20-15(17-12-5-2-1-3-6-12)13-7-4-8-14(18-13)19-10-9-16-11-19;1-5-3-2-4;/h4,7-12H,1-3,5-6H2,(H,17,20);4H,2-3H2,1H3;1H |
| InChIKey | NTUJSGHEFLXVEP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |