C19H25N5O3 — CID 166481495
tert-butyl 4-[(6-imidazol-1-ylpyridine-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 166481495) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is tert-butyl 4-[(6-imidazol-1-ylpyridine-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-imidazol-1-ylpyridine-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166481495 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | tert-butyl 4-[(6-imidazol-1-ylpyridine-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cccc(-n3ccnc3)n2)CC1 |
| InChI | InChI=1S/C19H25N5O3/c1-19(2,3)27-18(26)23-10-7-14(8-11-23)21-17(25)15-5-4-6-16(22-15)24-12-9-20-13-24/h4-6,9,12-14H,7-8,10-11H2,1-3H3,(H,21,25) |
| InChIKey | UZSNWVXSEDZTLT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |