C15H21F2N5O — CID 166481425
N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;difluoromethane;molecular hydrogen (PubChem CID 166481425) has the molecular formula C15H21F2N5O and a molecular weight of 325.36 g/mol. Its IUPAC name is N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;difluoromethane;molecular hydrogen.
| Compound Name | N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;difluoromethane;molecular hydrogen |
|---|---|
| PubChem CID | 166481425 |
| Molecular Formula | C15H21F2N5O |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;difluoromethane;molecular hydrogen |
| SMILES | FCF.O=C(NC1CCCCC1)c1cncc(-n2ccnc2)n1.[H][H] |
| InChI | InChI=1S/C14H17N5O.CH2F2.H2/c20-14(17-11-4-2-1-3-5-11)12-8-16-9-13(18-12)19-7-6-15-10-19;2-1-3;/h6-11H,1-5H2,(H,17,20);1H2;1H |
| InChIKey | CPEMIXZQYUOTQJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |