C16H21F2N5O — CID 166481244
N-cyclohexyl-6-(3-methylimidazol-4-yl)pyrazine-2-carboxamide;difluoromethane (PubChem CID 166481244) has the molecular formula C16H21F2N5O and a molecular weight of 337.37 g/mol. Its IUPAC name is N-cyclohexyl-6-(3-methylimidazol-4-yl)pyrazine-2-carboxamide;difluoromethane.
| Compound Name | N-cyclohexyl-6-(3-methylimidazol-4-yl)pyrazine-2-carboxamide;difluoromethane |
|---|---|
| PubChem CID | 166481244 |
| Molecular Formula | C16H21F2N5O |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-cyclohexyl-6-(3-methylimidazol-4-yl)pyrazine-2-carboxamide;difluoromethane |
| SMILES | Cn1cncc1-c1cncc(C(=O)NC2CCCCC2)n1.FCF |
| InChI | InChI=1S/C15H19N5O.CH2F2/c1-20-10-17-9-14(20)12-7-16-8-13(19-12)15(21)18-11-5-3-2-4-6-11;2-1-3/h7-11H,2-6H2,1H3,(H,18,21);1H2 |
| InChIKey | YYTSGMJBJGWDAX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |