C21H31N5O3 — CID 166481588
N-cyclobutyl-2-(3-methylimidazol-4-yl)-6-(oxan-4-yl)pyrimidine-4-carboxamide;propan-2-ol (PubChem CID 166481588) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-cyclobutyl-2-(3-methylimidazol-4-yl)-6-(oxan-4-yl)pyrimidine-4-carboxamide;propan-2-ol.
| Compound Name | N-cyclobutyl-2-(3-methylimidazol-4-yl)-6-(oxan-4-yl)pyrimidine-4-carboxamide;propan-2-ol |
|---|---|
| PubChem CID | 166481588 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-cyclobutyl-2-(3-methylimidazol-4-yl)-6-(oxan-4-yl)pyrimidine-4-carboxamide;propan-2-ol |
| SMILES | CC(C)O.Cn1cncc1-c1nc(C(=O)NC2CCC2)cc(C2CCOCC2)n1 |
| InChI | InChI=1S/C18H23N5O2.C3H8O/c1-23-11-19-10-16(23)17-21-14(12-5-7-25-8-6-12)9-15(22-17)18(24)20-13-3-2-4-13;1-3(2)4/h9-13H,2-8H2,1H3,(H,20,24);3-4H,1-2H3 |
| InChIKey | GYGGXZROBKQMBW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |