C17H23N5O — CID 166481590
N-(1-tert-butylpyrrolidin-3-yl)-2-imidazol-1-ylpyridine-4-carboxamide (PubChem CID 166481590) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1-tert-butylpyrrolidin-3-yl)-2-imidazol-1-ylpyridine-4-carboxamide.
| Compound Name | N-(1-tert-butylpyrrolidin-3-yl)-2-imidazol-1-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 166481590 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(1-tert-butylpyrrolidin-3-yl)-2-imidazol-1-ylpyridine-4-carboxamide |
| SMILES | CC(C)(C)N1CCC(NC(=O)c2ccnc(-n3ccnc3)c2)C1 |
| InChI | InChI=1S/C17H23N5O/c1-17(2,3)22-8-5-14(11-22)20-16(23)13-4-6-19-15(10-13)21-9-7-18-12-21/h4,6-7,9-10,12,14H,5,8,11H2,1-3H3,(H,20,23) |
| InChIKey | XOZLZHNYHYSITD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |