C22H25N5O — CID 87045978
2-imidazol-1-yl-N-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]pyridine-4-carboxamide (PubChem CID 87045978) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-imidazol-1-yl-N-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87045978 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-imidazol-1-yl-N-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]pyridine-4-carboxamide |
| SMILES | CC1CCCN(Cc2ccc(NC(=O)c3ccnc(-n4ccnc4)c3)cc2)C1 |
| InChI | InChI=1S/C22H25N5O/c1-17-3-2-11-26(14-17)15-18-4-6-20(7-5-18)25-22(28)19-8-9-24-21(13-19)27-12-10-23-16-27/h4-10,12-13,16-17H,2-3,11,14-15H2,1H3,(H,25,28) |
| InChIKey | NAOAYIGAPSALQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |