C21H21N5O2 — CID 172628369
7-cyano-3-imidazol-1-yl-N-(4-methoxycyclohexyl)isoquinoline-1-carboxamide (PubChem CID 172628369) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 7-cyano-3-imidazol-1-yl-N-(4-methoxycyclohexyl)isoquinoline-1-carboxamide.
| Compound Name | 7-cyano-3-imidazol-1-yl-N-(4-methoxycyclohexyl)isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 172628369 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 7-cyano-3-imidazol-1-yl-N-(4-methoxycyclohexyl)isoquinoline-1-carboxamide |
| SMILES | COC1CCC(NC(=O)c2nc(-n3ccnc3)cc3ccc(C#N)cc23)CC1 |
| InChI | InChI=1S/C21H21N5O2/c1-28-17-6-4-16(5-7-17)24-21(27)20-18-10-14(12-22)2-3-15(18)11-19(25-20)26-9-8-23-13-26/h2-3,8-11,13,16-17H,4-7H2,1H3,(H,24,27) |
| InChIKey | DMROTTCTGVLREG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |