C26H39N5O4Si — CID 175222075
5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]-1-(2-trimethylsilylethoxymethyl)indazole-7-carboxamide (PubChem CID 175222075) has the molecular formula C26H39N5O4Si and a molecular weight of 513.72 g/mol. Its IUPAC name is 5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]-1-(2-trimethylsilylethoxymethyl)indazole-7-carboxamide.
| Compound Name | 5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]-1-(2-trimethylsilylethoxymethyl)indazole-7-carboxamide |
|---|---|
| PubChem CID | 175222075 |
| Molecular Formula | C26H39N5O4Si |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexyl]-1-(2-trimethylsilylethoxymethyl)indazole-7-carboxamide |
| SMILES | COCCOC1CCC(NC(=O)c2cc(-n3ccnc3)cc3cnn(COCC[Si](C)(C)C)c23)CC1 |
| InChI | InChI=1S/C26H39N5O4Si/c1-33-11-12-35-23-7-5-21(6-8-23)29-26(32)24-16-22(30-10-9-27-18-30)15-20-17-28-31(25(20)24)19-34-13-14-36(2,3)4/h9-10,15-18,21,23H,5-8,11-14,19H2,1-4H3,(H,29,32) |
| InChIKey | YLNFJWFNXSGJMO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|