C27H37N5O5 — CID 165388326
[1-[5-imidazol-1-yl-7-[[4-(2-methoxyethoxy)cyclohexyl]carbamoyl]-1H-indol-2-yl]-2,2-dimethylpropyl] carbamate (PubChem CID 165388326) has the molecular formula C27H37N5O5 and a molecular weight of 511.62 g/mol. Its IUPAC name is [1-[5-imidazol-1-yl-7-[[4-(2-methoxyethoxy)cyclohexyl]carbamoyl]-1H-indol-2-yl]-2,2-dimethylpropyl] carbamate.
| Compound Name | [1-[5-imidazol-1-yl-7-[[4-(2-methoxyethoxy)cyclohexyl]carbamoyl]-1H-indol-2-yl]-2,2-dimethylpropyl] carbamate |
|---|---|
| PubChem CID | 165388326 |
| Molecular Formula | C27H37N5O5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [1-[5-imidazol-1-yl-7-[[4-(2-methoxyethoxy)cyclohexyl]carbamoyl]-1H-indol-2-yl]-2,2-dimethylpropyl] carbamate |
| SMILES | COCCOC1CCC(NC(=O)c2cc(-n3ccnc3)cc3cc(C(OC(N)=O)C(C)(C)C)[nH]c23)CC1 |
| InChI | InChI=1S/C27H37N5O5/c1-27(2,3)24(37-26(28)34)22-14-17-13-19(32-10-9-29-16-32)15-21(23(17)31-22)25(33)30-18-5-7-20(8-6-18)36-12-11-35-4/h9-10,13-16,18,20,24,31H,5-8,11-12H2,1-4H3,(H2,28,34)(H,30,33) |
| InChIKey | AFPJUKZUIKHYFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|