C19H21F3N4O3 — CID 156885949
6-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 156885949) has the molecular formula C19H21F3N4O3 and a molecular weight of 410.40 g/mol. Its IUPAC name is 6-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 6-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156885949 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 6-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | COCCOC1CCC(=NC(=O)c2cc(C(F)(F)F)cc(-n3ccnc3)n2)CC1 |
| InChI | InChI=1S/C19H21F3N4O3/c1-28-8-9-29-15-4-2-14(3-5-15)24-18(27)16-10-13(19(20,21)22)11-17(25-16)26-7-6-23-12-26/h6-7,10-12,15H,2-5,8-9H2,1H3/b24-14- |
| InChIKey | BSMHTCXLQYUVGG-OYKKKHCWSA-N |
| XLogP | 3.47 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|