C22H26N4O4 — CID 156733664
3-(hydroxymethyl)-5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-1H-indole-7-carboxamide (PubChem CID 156733664) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-1H-indole-7-carboxamide.
| Compound Name | 3-(hydroxymethyl)-5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 156733664 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-(hydroxymethyl)-5-imidazol-1-yl-N-[4-(2-methoxyethoxy)cyclohexylidene]-1H-indole-7-carboxamide |
| SMILES | COCCOC1CCC(=NC(=O)c2cc(-n3ccnc3)cc3c(CO)c[nH]c23)CC1 |
| InChI | InChI=1S/C22H26N4O4/c1-29-8-9-30-18-4-2-16(3-5-18)25-22(28)20-11-17(26-7-6-23-14-26)10-19-15(13-27)12-24-21(19)20/h6-7,10-12,14,18,24,27H,2-5,8-9,13H2,1H3/b25-16- |
| InChIKey | SPGBDYXMBFPWEL-XYGWBWBKSA-N |
| XLogP | 3.03 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|