C19H14Br2Si — CID 155787125
3,7-dibromo-5-methyl-5-phenylbenzo[b][1]benzosilole (PubChem CID 155787125) has the molecular formula C19H14Br2Si and a molecular weight of 430.22 g/mol. Its IUPAC name is 3,7-dibromo-5-methyl-5-phenylbenzo[b][1]benzosilole.
| Compound Name | 3,7-dibromo-5-methyl-5-phenylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 155787125 |
| Molecular Formula | C19H14Br2Si |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 3,7-dibromo-5-methyl-5-phenylbenzo[b][1]benzosilole |
| SMILES | C[Si]1(c2ccccc2)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C19H14Br2Si/c1-22(15-5-3-2-4-6-15)18-11-13(20)7-9-16(18)17-10-8-14(21)12-19(17)22/h2-12H,1H3 |
| InChIKey | JYCGYNRPGJJMBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|