C36H23N5O2 — CID 155792283
2-nitro-5-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)benzonitrile (PubChem CID 155792283) has the molecular formula C36H23N5O2 and a molecular weight of 557.61 g/mol. Its IUPAC name is 2-nitro-5-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)benzonitrile.
| Compound Name | 2-nitro-5-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)benzonitrile |
|---|---|
| PubChem CID | 155792283 |
| Molecular Formula | C36H23N5O2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-nitro-5-(8-trityl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)benzonitrile |
| SMILES | N#Cc1cc(-c2ccc3c4cnccc4n(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H23N5O2/c37-23-26-22-25(16-19-33(26)41(42)43)32-18-17-30-31-24-38-21-20-34(31)40(35(30)39-32)36(27-10-4-1-5-11-27,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-22,24H |
| InChIKey | ZAKKIVUTQDASDO-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 97.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|