C58H38N4 — CID 155792569
8-[3-[3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline (PubChem CID 155792569) has the molecular formula C58H38N4 and a molecular weight of 790.97 g/mol. Its IUPAC name is 8-[3-[3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline.
| Compound Name | 8-[3-[3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline |
|---|---|
| PubChem CID | 155792569 |
| Molecular Formula | C58H38N4 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 790.31 |
| IUPAC Name | 8-[3-[3-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5cccc(-c6cccc(-c7ccc8c(ccc9ccncc98)c7)c6)c5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C58H38N4/c1-3-9-39(10-4-1)41-17-24-45(25-18-41)56-60-57(46-26-19-42(20-27-46)40-11-5-2-6-12-40)62-58(61-56)47-28-21-43(22-29-47)48-13-7-14-49(35-48)50-15-8-16-51(36-50)52-31-32-54-53(37-52)30-23-44-33-34-59-38-55(44)54/h1-38H |
| InChIKey | JYKRSBBNHJGMNL-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|