C52H34N4 — CID 155792731
8-[3-[3-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline (PubChem CID 155792731) has the molecular formula C52H34N4 and a molecular weight of 714.87 g/mol. Its IUPAC name is 8-[3-[3-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline.
| Compound Name | 8-[3-[3-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline |
|---|---|
| PubChem CID | 155792731 |
| Molecular Formula | C52H34N4 |
| Molecular Weight | 714.87 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | 8-[3-[3-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]benzo[h]isoquinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cccc(-c6cccc(-c7ccc8c(ccc9ccncc98)c7)c6)c5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C52H34N4/c1-3-9-35(10-4-1)36-17-22-40(23-18-36)51-54-50(39-11-5-2-6-12-39)55-52(56-51)41-24-19-37(20-25-41)42-13-7-14-43(31-42)44-15-8-16-45(32-44)46-27-28-48-47(33-46)26-21-38-29-30-53-34-49(38)48/h1-34H |
| InChIKey | MXZAHYJWSRQQDT-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.87 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|