C16H31BO3 — CID 155793392
[1-ethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentyl]methanol (PubChem CID 155793392) has the molecular formula C16H31BO3 and a molecular weight of 282.23 g/mol. Its IUPAC name is [1-ethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentyl]methanol.
| Compound Name | [1-ethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 155793392 |
| Molecular Formula | C16H31BO3 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | [1-ethyl-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclopentyl]methanol |
| SMILES | CCC1(CO)CCC(CCB2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C16H31BO3/c1-6-16(12-18)9-7-13(11-16)8-10-17-19-14(2,3)15(4,5)20-17/h13,18H,6-12H2,1-5H3 |
| InChIKey | WMZCMEFDRSNPMU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|