C15H29BO3 — CID 160544950
[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentyl]methanol (PubChem CID 160544950) has the molecular formula C15H29BO3 and a molecular weight of 268.21 g/mol. Its IUPAC name is [2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentyl]methanol.
| Compound Name | [2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 160544950 |
| Molecular Formula | C15H29BO3 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]cyclopentyl]methanol |
| SMILES | CC1(C)OB(CCCC2CCCC2CO)OC1(C)C |
| InChI | InChI=1S/C15H29BO3/c1-14(2)15(3,4)19-16(18-14)10-6-9-12-7-5-8-13(12)11-17/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | YVEQHZJGKGDXTH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|