C27H55BO3 — CID 125479447
(3S)-5-octyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tridecan-3-ol (PubChem CID 125479447) has the molecular formula C27H55BO3 and a molecular weight of 438.55 g/mol. Its IUPAC name is (3S)-5-octyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tridecan-3-ol.
| Compound Name | (3S)-5-octyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tridecan-3-ol |
|---|---|
| PubChem CID | 125479447 |
| Molecular Formula | C27H55BO3 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.42 |
| IUPAC Name | (3S)-5-octyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)tridecan-3-ol |
| SMILES | CCCCCCCCC(CCCCCCCC)C[C@@H](O)CCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H55BO3/c1-7-9-11-13-15-17-19-24(20-18-16-14-12-10-8-2)23-25(29)21-22-28-30-26(3,4)27(5,6)31-28/h24-25,29H,7-23H2,1-6H3/t25-/m0/s1 |
| InChIKey | YQGFJJLLOFZNAP-VWLOTQADSA-N |
| XLogP | 8.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|